- 전세계 배송
- 품질 보증
- 연중무휴 고객 서비스
제품 소개
제품 설명
7-Deaza-6-hydroxypurine(CAS:3680-71-5) is a skeleton of nucleosides that inhibits enzymes. It has been shown to inhibit the activity of hydrochloric acid, a tumor metastasis promoter. The constant for this drug was determined using molecular modeling and inhibition constants. 7-Deaza-6-hydroxypurine(CAS:3680-71-5) has anticancer activity and can be used for the treatment of cancer. This drug is used as a noncompetitive inhibitor in which it binds to two different sites on the enzyme. It has also been shown to bind to subunits, which are parts of a protein that make up its structure, in biological studies.br>7-데아자-6-하이드록시퓨린(CAS:3680-71-5)은 효소의 서로 다른 두 부위에 결합하는 억제제입니다. 항암 활성이 있는 것으로 나타났으며 암 치료에 사용할 수 있습니다. 이 약물은 효소의 서로 다른 두 부위에 결합하는 비경쟁적 억제제로 사용됩니다.
사양
|
항목 |
사양 |
|
IUPAC 이름 |
3,7-디하이드로피롤로[2,3-d]피리미딘-4-원 |
|
MDL 번호 |
MFCD08445809 |
|
비점 |
760mmHg에서 473도 |
|
녹는 점 |
345-348 학위 |
|
인화점 |
239.9±21.2 정도 |
|
밀도 |
1.6±0.1g/cm3 |
|
PSA |
61.54 |
|
LogP |
-0.70 |
|
모습 |
미색에서 밝은 갈색(고체) |
|
용해도 |
DMSO에 용해 |
|
증기 압력 |
25도에서 {{0}}.0±1.2 mmHg |
|
굴절률 |
1.784 |
|
보관 조건 |
어두운 곳에 보관, 건조, 실온 밀봉 |
|
InChI |
InChI=1S/C6H5N3O/c10-6-4-1-2-7-5(4)8-3-9-6/h1-3H,(H2,7,8,9,10) |
|
인치키 |
FBMZEITWVNHWJW-UHFFFAOYSA-N |

인기 탭: 카스:3680-71-5|7-deazahypoxanthine, 가격, 견적, 할인, 재고 있음, 판매







![CAS 1408282-26-7|8-플루오로-1,3,4,5-테트라하이드로-아제피노[5,4,3-cd]인돌-6-온](/uploads/202235855/small/cas-1408282-26-7-8-fluoro-1-3-4-5-tetrahydro57374852633.png?size=384x0)
